C24H28N4O2+2 — CID 2461981
(2R)-N-(3-methoxyphenyl)-2-phenyl-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide (PubChem CID 2461981) has the molecular formula C24H28N4O2+2 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R)-N-(3-methoxyphenyl)-2-phenyl-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | (2R)-N-(3-methoxyphenyl)-2-phenyl-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2461981 |
| Molecular Formula | C24H28N4O2+2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (2R)-N-(3-methoxyphenyl)-2-phenyl-2-(4-pyridin-1-ium-2-ylpiperazin-1-ium-1-yl)acetamide |
| SMILES | COc1cccc(NC(=O)[C@@H](c2ccccc2)[NH+]2CCN(c3cccc[nH+]3)CC2)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-30-21-11-7-10-20(18-21)26-24(29)23(19-8-3-2-4-9-19)28-16-14-27(15-17-28)22-12-5-6-13-25-22/h2-13,18,23H,14-17H2,1H3,(H,26,29)/p+2/t23-/m1/s1 |
| InChIKey | WFEOFCGAGGZJAP-HSZRJFAPSA-P |
| XLogP | 1.59 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |