C26H30N3O2+ — CID 8726382
(2S)-N-(3-methoxyphenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-2-phenylacetamide (PubChem CID 8726382) has the molecular formula C26H30N3O2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is (2S)-N-(3-methoxyphenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-N-(3-methoxyphenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 8726382 |
| Molecular Formula | C26H30N3O2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (2S)-N-(3-methoxyphenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]-2-phenylacetamide |
| SMILES | COc1cccc(NC(=O)[C@H](c2ccccc2)[NH+]2CCN(c3ccccc3C)CC2)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-20-9-6-7-14-24(20)28-15-17-29(18-16-28)25(21-10-4-3-5-11-21)26(30)27-22-12-8-13-23(19-22)31-2/h3-14,19,25H,15-18H2,1-2H3,(H,27,30)/p+1/t25-/m0/s1 |
| InChIKey | UUOKAZYXJXXYAT-VWLOTQADSA-O |
| XLogP | 3.09 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |