C26H30N3O+ — CID 4986317
N-(2,6-dimethylphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 4986317) has the molecular formula C26H30N3O+ and a molecular weight of 400.55 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 4986317 |
| Molecular Formula | C26H30N3O+ |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(c1ccccc1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O/c1-20-10-9-11-21(2)24(20)27-26(30)25(22-12-5-3-6-13-22)29-18-16-28(17-19-29)23-14-7-4-8-15-23/h3-15,25H,16-19H2,1-2H3,(H,27,30)/p+1 |
| InChIKey | JQIOULURPITADE-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |