C25H27ClN3O2+ — CID 2549165
(2R)-N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide (PubChem CID 2549165) has the molecular formula C25H27ClN3O2+ and a molecular weight of 436.96 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide.
| Compound Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2549165 |
| Molecular Formula | C25H27ClN3O2+ |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (2R)-N-(3-chloro-4-methoxyphenyl)-2-phenyl-2-(4-phenylpiperazin-1-ium-1-yl)acetamide |
| SMILES | COc1ccc(NC(=O)[C@@H](c2ccccc2)[NH+]2CCN(c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O2/c1-31-23-13-12-20(18-22(23)26)27-25(30)24(19-8-4-2-5-9-19)29-16-14-28(15-17-29)21-10-6-3-7-11-21/h2-13,18,24H,14-17H2,1H3,(H,27,30)/p+1/t24-/m1/s1 |
| InChIKey | RQMRJSFVRKQMEB-XMMPIXPASA-O |
| XLogP | 3.43 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |