C21H14N4O — CID 24622659
2-[4-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]phenyl]benzonitrile (PubChem CID 24622659) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[4-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]phenyl]benzonitrile.
| Compound Name | 2-[4-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 24622659 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-[4-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(Cn2nnc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C21H14N4O/c22-13-17-5-1-2-6-18(17)16-11-9-15(10-12-16)14-25-21(26)19-7-3-4-8-20(19)23-24-25/h1-12H,14H2 |
| InChIKey | CRYBFPVPFWJIOD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |