C14H10Cl3N3O3S — CID 24639839
2-(4-nitrophenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide (PubChem CID 24639839) has the molecular formula C14H10Cl3N3O3S and a molecular weight of 406.68 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide.
| Compound Name | 2-(4-nitrophenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 24639839 |
| Molecular Formula | C14H10Cl3N3O3S |
| Molecular Weight | 406.68 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 2-(4-nitrophenyl)sulfanyl-N'-(2,4,6-trichlorophenyl)acetohydrazide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3N3O3S/c15-8-5-11(16)14(12(17)6-8)19-18-13(21)7-24-10-3-1-9(2-4-10)20(22)23/h1-6,19H,7H2,(H,18,21) |
| InChIKey | WSGZZGOHTSAUNE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.68 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|