C21H19F3N4O4S — CID 24642535
2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide (PubChem CID 24642535) has the molecular formula C21H19F3N4O4S and a molecular weight of 480.47 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide.
| Compound Name | 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 24642535 |
| Molecular Formula | C21H19F3N4O4S |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-4-yl)methoxy]-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]benzamide |
| SMILES | Cc1nc(COc2ccccc2C(=O)NCCNc2ccc(C(F)(F)F)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C21H19F3N4O4S/c1-13-27-15(12-33-13)11-32-19-5-3-2-4-16(19)20(29)26-9-8-25-17-7-6-14(21(22,23)24)10-18(17)28(30)31/h2-7,10,12,25H,8-9,11H2,1H3,(H,26,29) |
| InChIKey | VAENIMFNGICNDL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|