C15H15N3O3 — CID 24648877
(3-methyl-1,2,4-oxadiazol-5-yl)methyl 3-indol-1-ylpropanoate (PubChem CID 24648877) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (3-methyl-1,2,4-oxadiazol-5-yl)methyl 3-indol-1-ylpropanoate.
| Compound Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 3-indol-1-ylpropanoate |
|---|---|
| PubChem CID | 24648877 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (3-methyl-1,2,4-oxadiazol-5-yl)methyl 3-indol-1-ylpropanoate |
| SMILES | Cc1noc(COC(=O)CCn2ccc3ccccc32)n1 |
| InChI | InChI=1S/C15H15N3O3/c1-11-16-14(21-17-11)10-20-15(19)7-9-18-8-6-12-4-2-3-5-13(12)18/h2-6,8H,7,9-10H2,1H3 |
| InChIKey | ZYIOHNBRAMRXKH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |