C17H22N2O3 — CID 84557932
ethyl 3-[3-indol-1-ylpropanoyl(methyl)amino]propanoate (PubChem CID 84557932) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethyl 3-[3-indol-1-ylpropanoyl(methyl)amino]propanoate.
| Compound Name | ethyl 3-[3-indol-1-ylpropanoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 84557932 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | ethyl 3-[3-indol-1-ylpropanoyl(methyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(C)C(=O)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C17H22N2O3/c1-3-22-17(21)10-11-18(2)16(20)9-13-19-12-8-14-6-4-5-7-15(14)19/h4-8,12H,3,9-11,13H2,1-2H3 |
| InChIKey | ASGWUKQQXWIYNA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |