C17H18N4O — CID 51095546
N,N-bis(2-cyanoethyl)-3-indol-1-ylpropanamide (PubChem CID 51095546) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-3-indol-1-ylpropanamide.
| Compound Name | N,N-bis(2-cyanoethyl)-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 51095546 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-3-indol-1-ylpropanamide |
| SMILES | N#CCCN(CCC#N)C(=O)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C17H18N4O/c18-9-3-11-21(12-4-10-19)17(22)8-14-20-13-7-15-5-1-2-6-16(15)20/h1-2,5-7,13H,3-4,8,11-12,14H2 |
| InChIKey | OGNZWBSDVIYECC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |