C19H16Cl2N2O3 — CID 40680707
[2-(2,3-dichloroanilino)-2-oxoethyl] 3-indol-1-ylpropanoate (PubChem CID 40680707) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 3-indol-1-ylpropanoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-indol-1-ylpropanoate |
|---|---|
| PubChem CID | 40680707 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-indol-1-ylpropanoate |
| SMILES | O=C(COC(=O)CCn1ccc2ccccc21)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H16Cl2N2O3/c20-14-5-3-6-15(19(14)21)22-17(24)12-26-18(25)9-11-23-10-8-13-4-1-2-7-16(13)23/h1-8,10H,9,11-12H2,(H,22,24) |
| InChIKey | JYZSWYVEAFKVRE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |