C15H14Cl2N4O3 — CID 55701724
[2-(2,3-dichloroanilino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate (PubChem CID 55701724) has the molecular formula C15H14Cl2N4O3 and a molecular weight of 369.21 g/mol. Its IUPAC name is [2-(2,3-dichloroanilino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate.
| Compound Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
|---|---|
| PubChem CID | 55701724 |
| Molecular Formula | C15H14Cl2N4O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | [2-(2,3-dichloroanilino)-2-oxoethyl] 3-(pyrimidin-2-ylamino)propanoate |
| SMILES | O=C(COC(=O)CCNc1ncccn1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H14Cl2N4O3/c16-10-3-1-4-11(14(10)17)21-12(22)9-24-13(23)5-8-20-15-18-6-2-7-19-15/h1-4,6-7H,5,8-9H2,(H,21,22)(H,18,19,20) |
| InChIKey | IIDXCOSHOJNJIW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |