C23H23ClN4O3S — CID 24650827
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(2,4-dimethylphenyl)carbamoyl]propanamide (PubChem CID 24650827) has the molecular formula C23H23ClN4O3S and a molecular weight of 470.98 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(2,4-dimethylphenyl)carbamoyl]propanamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(2,4-dimethylphenyl)carbamoyl]propanamide |
|---|---|
| PubChem CID | 24650827 |
| Molecular Formula | C23H23ClN4O3S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[(2,4-dimethylphenyl)carbamoyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NC(=O)Nc2ccc(C)cc2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H23ClN4O3S/c1-5-10-28-21(30)17-8-7-16(24)12-19(17)26-23(28)32-15(4)20(29)27-22(31)25-18-9-6-13(2)11-14(18)3/h5-9,11-12,15H,1,10H2,2-4H3,(H2,25,27,29,31) |
| InChIKey | BOOWBALQCKSTEM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|