C21H19N3O3S — CID 24670839
4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile (PubChem CID 24670839) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 24670839 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-ylsulfanyl)-2-(1,3-dimethylbenzimidazol-2-ylidene)-3-oxobutanenitrile |
| SMILES | CN1C(=C(C#N)C(=O)CSc2ccc3c(c2)OCCO3)N(C)c2ccccc21 |
| InChI | InChI=1S/C21H19N3O3S/c1-23-16-5-3-4-6-17(16)24(2)21(23)15(12-22)18(25)13-28-14-7-8-19-20(11-14)27-10-9-26-19/h3-8,11H,9-10,13H2,1-2H3 |
| InChIKey | OXQPKQFTWJDUHD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|