C14H12N4O3S — CID 24679869
1-(4-nitrophenyl)-2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanol (PubChem CID 24679869) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanol.
| Compound Name | 1-(4-nitrophenyl)-2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanol |
|---|---|
| PubChem CID | 24679869 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-(4-nitrophenyl)-2-(thieno[3,2-d]pyrimidin-4-ylamino)ethanol |
| SMILES | O=[N+]([O-])c1ccc(C(O)CNc2ncnc3ccsc23)cc1 |
| InChI | InChI=1S/C14H12N4O3S/c19-12(9-1-3-10(4-2-9)18(20)21)7-15-14-13-11(5-6-22-13)16-8-17-14/h1-6,8,12,19H,7H2,(H,15,16,17) |
| InChIKey | IXGRZSIQGRILLQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|