C15H11N5O4S2 — CID 46661780
4-nitro-N'-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)benzohydrazide (PubChem CID 46661780) has the molecular formula C15H11N5O4S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-nitro-N'-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)benzohydrazide.
| Compound Name | 4-nitro-N'-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 46661780 |
| Molecular Formula | C15H11N5O4S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 4-nitro-N'-(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)benzohydrazide |
| SMILES | O=C(CSc1ncnc2ccsc12)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11N5O4S2/c21-12(7-26-15-13-11(5-6-25-13)16-8-17-15)18-19-14(22)9-1-3-10(4-2-9)20(23)24/h1-6,8H,7H2,(H,18,21)(H,19,22) |
| InChIKey | AQZHJOLTJBLQOW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|