C22H19N3O5S — CID 24684798
N-[2-[(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamoyl]phenyl]-N-methylthiophene-2-carboxamide (PubChem CID 24684798) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[2-[(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamoyl]phenyl]-N-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24684798 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[2-[(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)carbamoyl]phenyl]-N-methylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1cccs1)c1ccccc1C(=O)NNC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C22H19N3O5S/c1-25(22(28)19-11-6-12-31-19)15-8-3-2-7-14(15)20(26)23-24-21(27)18-13-29-16-9-4-5-10-17(16)30-18/h2-12,18H,13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | UTFBESIZZSOCOP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|