C23H27N5O6 — CID 24687056
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide (PubChem CID 24687056) has the molecular formula C23H27N5O6 and a molecular weight of 469.50 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
|---|---|
| PubChem CID | 24687056 |
| Molecular Formula | C23H27N5O6 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methoxyethyl)-1,3-dioxo-2-prop-2-enylisoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)N(CCOC)c3c(N)n(CCCC)c(=O)[nH]c3=O)cc2C1=O |
| InChI | InChI=1S/C23H27N5O6/c1-4-6-10-27-18(24)17(19(29)25-23(27)33)26(11-12-34-3)20(30)14-7-8-15-16(13-14)22(32)28(9-5-2)21(15)31/h5,7-8,13H,2,4,6,9-12,24H2,1,3H3,(H,25,29,33) |
| InChIKey | FWCQUJBVPPYVQD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|