C16H19N3O6S — CID 24687908
(2-oxo-2-piperidin-1-ylethyl) 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate (PubChem CID 24687908) has the molecular formula C16H19N3O6S and a molecular weight of 381.41 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 24687908 |
| Molecular Formula | C16H19N3O6S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate |
| SMILES | NC(=O)c1ccc(SCC(=O)OCC(=O)N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O6S/c17-16(22)11-4-5-13(12(8-11)19(23)24)26-10-15(21)25-9-14(20)18-6-2-1-3-7-18/h4-5,8H,1-3,6-7,9-10H2,(H2,17,22) |
| InChIKey | IZPYLVPZCSZJSF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|