C17H21N3O6S — CID 24979358
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate (PubChem CID 24979358) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 24979358 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 2-(4-carbamoyl-2-nitrophenyl)sulfanylacetate |
| SMILES | CC1CCCN(C(=O)COC(=O)CSc2ccc(C(N)=O)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H21N3O6S/c1-11-3-2-6-19(8-11)15(21)9-26-16(22)10-27-14-5-4-12(17(18)23)7-13(14)20(24)25/h4-5,7,11H,2-3,6,8-10H2,1H3,(H2,18,23) |
| InChIKey | YHTAKRSOQOWQSV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|