C13H16N2OS — CID 24706047
N-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 24706047) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 24706047 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)C1CSCN1 |
| InChI | InChI=1S/C13H16N2OS/c16-13(12-7-17-8-14-12)15-11-5-4-9-2-1-3-10(9)6-11/h4-6,12,14H,1-3,7-8H2,(H,15,16) |
| InChIKey | UZFRHRCNTNLTQC-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |