C13H18N2O4S — CID 24709184
N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-sulfonamide (PubChem CID 24709184) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-sulfonamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 24709184 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OCCO2)C1CCCNC1 |
| InChI | InChI=1S/C13H18N2O4S/c16-20(17,11-2-1-5-14-9-11)15-10-3-4-12-13(8-10)19-7-6-18-12/h3-4,8,11,14-15H,1-2,5-7,9H2 |
| InChIKey | ULSWOULNHVYQJK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |