About N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide
N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide (PubChem CID 43107627) has the molecular formula C12H14F2N2O4S
and a molecular weight of 320.32 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide.
Molecular Properties
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide |
| PubChem CID | 43107627 |
| Molecular Formula | C12H14F2N2O4S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc2c(c1)OC(F)(F)O2)C1CCCNC1 |
| InChI | InChI=1S/C12H14F2N2O4S/c13-12(14)19-10-4-3-8(6-11(10)20-12)16-21(17,18)9-2-1-5-15-7-9/h3-4,6,9,15-16H,1-2,5,7H2 |
| InChIKey | DITKILPOUCEOGG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide?
The IUPAC name of N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide (CID 43107627) is N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide.
What is the SMILES notation for N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide?
The canonical SMILES for N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide is O=S(=O)(Nc1ccc2c(c1)OC(F)(F)O2)C1CCCNC1.
What is the InChIKey of N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide?
The InChIKey is DITKILPOUCEOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O4S/c13-12(14)19-10-4-3-8(6-11(10)20-12)16-21(17,18)9-2-1-5-15-7-9/h3-4,6,9,15-16H,1-2,5,7H2.
What are the key properties of N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide?
N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide has a molecular weight of 320.32 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoro-1,3-benzodioxol-5-yl)piperidine-3-sulfonamide is sourced from PubChem (CID 43107627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).