About 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea
1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea (PubChem CID 24712013) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea.
Molecular Properties
| Compound Name | 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea |
| PubChem CID | 24712013 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1cccc(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C16H16N4O2/c1-2-8-18-16(21)19-12-6-3-5-11(10-12)15-20-14-13(22-15)7-4-9-17-14/h3-7,9-10H,2,8H2,1H3,(H2,18,19,21) |
| InChIKey | BNNJBWCWRGXSKG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea?
The IUPAC name of 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea (CID 24712013) is 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea.
What is the SMILES notation for 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea?
The canonical SMILES for 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea is CCCNC(=O)Nc1cccc(-c2nc3ncccc3o2)c1.
What is the InChIKey of 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea?
The InChIKey is BNNJBWCWRGXSKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-2-8-18-16(21)19-12-6-3-5-11(10-12)15-20-14-13(22-15)7-4-9-17-14/h3-7,9-10H,2,8H2,1H3,(H2,18,19,21).
What are the key properties of 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea?
1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea has a molecular weight of 296.33 g/mol, XLogP of 3.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]-3-propylurea is sourced from PubChem (CID 24712013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).