C11H14BrN — CID 24721880
4-(2-bromoprop-2-enyl)-N,N-dimethylaniline (PubChem CID 24721880) has the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. Its IUPAC name is 4-(2-bromoprop-2-enyl)-N,N-dimethylaniline.
| Compound Name | 4-(2-bromoprop-2-enyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 24721880 |
| Molecular Formula | C11H14BrN |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-(2-bromoprop-2-enyl)-N,N-dimethylaniline |
| SMILES | C=C(Br)Cc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C11H14BrN/c1-9(12)8-10-4-6-11(7-5-10)13(2)3/h4-7H,1,8H2,2-3H3 |
| InChIKey | AEINQZSLQJIEFP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|