C19H19NOS — CID 24725530
[2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(2-methylsulfanylphenyl)methanone (PubChem CID 24725530) has the molecular formula C19H19NOS and a molecular weight of 309.43 g/mol. Its IUPAC name is [2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(2-methylsulfanylphenyl)methanone.
| Compound Name | [2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 24725530 |
| Molecular Formula | C19H19NOS |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | [2-(2,5-dihydropyrrol-1-ylmethyl)phenyl]-(2-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccccc1C(=O)c1ccccc1CN1CC=CC1 |
| InChI | InChI=1S/C19H19NOS/c1-22-18-11-5-4-10-17(18)19(21)16-9-3-2-8-15(16)14-20-12-6-7-13-20/h2-11H,12-14H2,1H3 |
| InChIKey | DMSFZLYMDBRDCO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|