C24H24N2O6S — CID 24730912
methyl 3-[[4-[4-(furan-2-yl)phenyl]sulfonylpiperidine-1-carbonyl]amino]benzoate (PubChem CID 24730912) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is methyl 3-[[4-[4-(furan-2-yl)phenyl]sulfonylpiperidine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[4-[4-(furan-2-yl)phenyl]sulfonylpiperidine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 24730912 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 3-[[4-[4-(furan-2-yl)phenyl]sulfonylpiperidine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-31-23(27)18-4-2-5-19(16-18)25-24(28)26-13-11-21(12-14-26)33(29,30)20-9-7-17(8-10-20)22-6-3-15-32-22/h2-10,15-16,21H,11-14H2,1H3,(H,25,28) |
| InChIKey | ZTGIIEDPHOECJI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |