C18H24N2O3S — CID 24732704
N-(furan-2-ylmethyl)-1-[(2-methylsulfonylphenyl)methyl]piperidin-4-amine (PubChem CID 24732704) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-[(2-methylsulfonylphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(furan-2-ylmethyl)-1-[(2-methylsulfonylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 24732704 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-[(2-methylsulfonylphenyl)methyl]piperidin-4-amine |
| SMILES | CS(=O)(=O)c1ccccc1CN1CCC(NCc2ccco2)CC1 |
| InChI | InChI=1S/C18H24N2O3S/c1-24(21,22)18-7-3-2-5-15(18)14-20-10-8-16(9-11-20)19-13-17-6-4-12-23-17/h2-7,12,16,19H,8-11,13-14H2,1H3 |
| InChIKey | QCANXPZPWYJDFA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |