C22H23ClFN3O2 — CID 24733263
3-[3-[4-[(2-chloro-4-fluorophenyl)methyl]-5-oxo-1,4-diazepan-1-yl]propoxy]benzonitrile (PubChem CID 24733263) has the molecular formula C22H23ClFN3O2 and a molecular weight of 415.90 g/mol. Its IUPAC name is 3-[3-[4-[(2-chloro-4-fluorophenyl)methyl]-5-oxo-1,4-diazepan-1-yl]propoxy]benzonitrile.
| Compound Name | 3-[3-[4-[(2-chloro-4-fluorophenyl)methyl]-5-oxo-1,4-diazepan-1-yl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 24733263 |
| Molecular Formula | C22H23ClFN3O2 |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[3-[4-[(2-chloro-4-fluorophenyl)methyl]-5-oxo-1,4-diazepan-1-yl]propoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCCN2CCC(=O)N(Cc3ccc(F)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C22H23ClFN3O2/c23-21-14-19(24)6-5-18(21)16-27-11-10-26(9-7-22(27)28)8-2-12-29-20-4-1-3-17(13-20)15-25/h1,3-6,13-14H,2,7-12,16H2 |
| InChIKey | ZNIDNEYDRWOGTG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|