C23H26ClN5O2S2 — CID 24739588
(2R,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;S-methyl 1,2,3-benzothiadiazole-7-carbothioate (PubChem CID 24739588) has the molecular formula C23H26ClN5O2S2 and a molecular weight of 504.08 g/mol. Its IUPAC name is (2R,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;S-methyl 1,2,3-benzothiadiazole-7-carbothioate.
| Compound Name | (2R,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
|---|---|
| PubChem CID | 24739588 |
| Molecular Formula | C23H26ClN5O2S2 |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | (2R,3R)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;S-methyl 1,2,3-benzothiadiazole-7-carbothioate |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](Cc1ccc(Cl)cc1)n1cncn1.CSC(=O)c1cccc2nnsc12 |
| InChI | InChI=1S/C15H20ClN3O.C8H6N2OS2/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11;1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h4-7,9-10,13-14,20H,8H2,1-3H3;2-4H,1H3/t13-,14+;/m1./s1 |
| InChIKey | IPHWVLHJNPGSFL-DFQHDRSWSA-N |
| XLogP | 5.32 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|