C21H36Cl2N8O — CID 176546368
2-butyl-1-carbamimidoylguanidine;(2S,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;hydrochloride (PubChem CID 176546368) has the molecular formula C21H36Cl2N8O and a molecular weight of 487.48 g/mol. Its IUPAC name is 2-butyl-1-carbamimidoylguanidine;(2S,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;hydrochloride.
| Compound Name | 2-butyl-1-carbamimidoylguanidine;(2S,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;hydrochloride |
|---|---|
| PubChem CID | 176546368 |
| Molecular Formula | C21H36Cl2N8O |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 2-butyl-1-carbamimidoylguanidine;(2S,3S)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pentan-3-ol;hydrochloride |
| SMILES | CC(C)(C)[C@H](O)[C@H](Cc1ccc(Cl)cc1)n1cncn1.Cl.[H]/N=C(\N)N/C(N)=N/CCCC |
| InChI | InChI=1S/C15H20ClN3O.C6H15N5.ClH/c1-15(2,3)14(20)13(19-10-17-9-18-19)8-11-4-6-12(16)7-5-11;1-2-3-4-10-6(9)11-5(7)8;/h4-7,9-10,13-14,20H,8H2,1-3H3;2-4H2,1H3,(H6,7,8,9,10,11);1H/t13-,14+;;/m0../s1 |
| InChIKey | AVRPTSODJRQOBU-WICJZZOFSA-N |
| XLogP | 3.13 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|