C18H14Cl2FN3O2 — CID 24740392
2,4-dichloro-5-fluoro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 24740392) has the molecular formula C18H14Cl2FN3O2 and a molecular weight of 394.23 g/mol. Its IUPAC name is 2,4-dichloro-5-fluoro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-5-fluoro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 24740392 |
| Molecular Formula | C18H14Cl2FN3O2 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2,4-dichloro-5-fluoro-N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2FN3O2/c1-9-6-16(25)23-24-17(9)10-2-4-11(5-3-10)22-18(26)12-7-15(21)14(20)8-13(12)19/h2-5,7-9H,6H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | IYTAYKHBEADEMX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|