C22H25N3 — CID 24743989
4-[4-[(3aR,6aR)-5-propyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]benzonitrile (PubChem CID 24743989) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-[4-[(3aR,6aR)-5-propyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(3aR,6aR)-5-propyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 24743989 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 4-[4-[(3aR,6aR)-5-propyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]benzonitrile |
| SMILES | CCCN1C[C@H]2CCN(c3ccc(-c4ccc(C#N)cc4)cc3)[C@H]2C1 |
| InChI | InChI=1S/C22H25N3/c1-2-12-24-15-20-11-13-25(22(20)16-24)21-9-7-19(8-10-21)18-5-3-17(14-23)4-6-18/h3-10,20,22H,2,11-13,15-16H2,1H3/t20-,22+/m1/s1 |
| InChIKey | TWIZVLLSPWGXFD-IRLDBZIGSA-N |
| XLogP | 4.15 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |