C22H27NO4S — CID 24749434
ethyl 2-[(3aR,5aS)-2-(4-methylphenyl)sulfonyl-3,3a,5a,6,7,8-hexahydro-1H-cyclopenta[e]isoindol-8-yl]acetate (PubChem CID 24749434) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is ethyl 2-[(3aR,5aS)-2-(4-methylphenyl)sulfonyl-3,3a,5a,6,7,8-hexahydro-1H-cyclopenta[e]isoindol-8-yl]acetate.
| Compound Name | ethyl 2-[(3aR,5aS)-2-(4-methylphenyl)sulfonyl-3,3a,5a,6,7,8-hexahydro-1H-cyclopenta[e]isoindol-8-yl]acetate |
|---|---|
| PubChem CID | 24749434 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 2-[(3aR,5aS)-2-(4-methylphenyl)sulfonyl-3,3a,5a,6,7,8-hexahydro-1H-cyclopenta[e]isoindol-8-yl]acetate |
| SMILES | CCOC(=O)CC1CC[C@H]2C=C[C@H]3CN(S(=O)(=O)c4ccc(C)cc4)CC3=C12 |
| InChI | InChI=1S/C22H27NO4S/c1-3-27-21(24)12-17-8-6-16-7-9-18-13-23(14-20(18)22(16)17)28(25,26)19-10-4-15(2)5-11-19/h4-5,7,9-11,16-18H,3,6,8,12-14H2,1-2H3/t16-,17?,18-/m0/s1 |
| InChIKey | BJACVGVCJLKUEU-RGBJRUIASA-N |
| XLogP | 3.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|