C21H26N2O5 — CID 24750606
N-[3-[[(3,4-dihydroxyphenyl)methylamino]methyl]cyclohexyl]-3,4-dihydroxybenzamide (PubChem CID 24750606) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[3-[[(3,4-dihydroxyphenyl)methylamino]methyl]cyclohexyl]-3,4-dihydroxybenzamide.
| Compound Name | N-[3-[[(3,4-dihydroxyphenyl)methylamino]methyl]cyclohexyl]-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 24750606 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[3-[[(3,4-dihydroxyphenyl)methylamino]methyl]cyclohexyl]-3,4-dihydroxybenzamide |
| SMILES | O=C(NC1CCCC(CNCc2ccc(O)c(O)c2)C1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H26N2O5/c24-17-6-4-14(9-19(17)26)12-22-11-13-2-1-3-16(8-13)23-21(28)15-5-7-18(25)20(27)10-15/h4-7,9-10,13,16,22,24-27H,1-3,8,11-12H2,(H,23,28) |
| InChIKey | LIPRDMSFQJVJIS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|