C16H22O3 — CID 24752382
ethyl (1S,8R,9R)-11-methyl-12-oxotricyclo[6.2.2.01,6]dodec-6-ene-9-carboxylate (PubChem CID 24752382) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl (1S,8R,9R)-11-methyl-12-oxotricyclo[6.2.2.01,6]dodec-6-ene-9-carboxylate.
| Compound Name | ethyl (1S,8R,9R)-11-methyl-12-oxotricyclo[6.2.2.01,6]dodec-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 24752382 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | ethyl (1S,8R,9R)-11-methyl-12-oxotricyclo[6.2.2.01,6]dodec-6-ene-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@]23CCCCC2=C[C@H]1C(=O)C3C |
| InChI | InChI=1S/C16H22O3/c1-3-19-15(18)13-9-16-7-5-4-6-11(16)8-12(13)14(17)10(16)2/h8,10,12-13H,3-7,9H2,1-2H3/t10?,12-,13-,16+/m1/s1 |
| InChIKey | RHWVXDOIKBOPRN-WJHBYISYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|