C13H17NO4 — CID 24753909
2-amino-3-[4-(1,3-dioxan-2-yl)phenyl]propanoic acid (PubChem CID 24753909) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-amino-3-[4-(1,3-dioxan-2-yl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(1,3-dioxan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 24753909 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-amino-3-[4-(1,3-dioxan-2-yl)phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(C2OCCCO2)cc1)C(=O)O |
| InChI | InChI=1S/C13H17NO4/c14-11(12(15)16)8-9-2-4-10(5-3-9)13-17-6-1-7-18-13/h2-5,11,13H,1,6-8,14H2,(H,15,16) |
| InChIKey | WJCWSDBXWOAZGT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |