methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate

C19H18N2O3 — CID 24755552

IUPACmethyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate
SMILESCOC(=O)C(N)Cc1ccc2nc(Oc3ccccc3)ccc2c1
InChIInChI=1S/C19H18N2O3/c1-23-19(22)16(20)12-13-7-9-17-14(11-13)8-10-18(21-17)24-15-5-3-2-4-6-15/h2-11,16H,12,20H2,1H3
InChIKeyRARAOODWVODFGU-UHFFFAOYSA-N
MW322.36 g/mol
LogP3.07
Rot. Bonds5

About methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate

methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate (PubChem CID 24755552) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate
PubChem CID24755552
Molecular FormulaC19H18N2O3
Molecular Weight322.36 g/mol
Exact Mass322.13
IUPAC Namemethyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate
SMILESCOC(=O)C(N)Cc1ccc2nc(Oc3ccccc3)ccc2c1
InChIInChI=1S/C19H18N2O3/c1-23-19(22)16(20)12-13-7-9-17-14(11-13)8-10-18(21-17)24-15-5-3-2-4-6-15/h2-11,16H,12,20H2,1H3
InChIKeyRARAOODWVODFGU-UHFFFAOYSA-N
XLogP3.07
TPSA74.44 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.36
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate?
The IUPAC name of methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate (CID 24755552) is methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate.
What is the SMILES notation for methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate?
The canonical SMILES for methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate is COC(=O)C(N)Cc1ccc2nc(Oc3ccccc3)ccc2c1.
What is the InChIKey of methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate?
The InChIKey is RARAOODWVODFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-23-19(22)16(20)12-13-7-9-17-14(11-13)8-10-18(21-17)24-15-5-3-2-4-6-15/h2-11,16H,12,20H2,1H3.
What are the key properties of methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate?
methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate has a molecular weight of 322.36 g/mol, XLogP of 3.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-3-(2-phenoxyquinolin-6-yl)propanoate is sourced from PubChem (CID 24755552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).