C25H28N6O2 — CID 24760535
N-[3-(dimethylamino)propyl]-4-[[6-(1H-indol-2-yl)pyrazin-2-yl]amino]-3-methoxybenzamide (PubChem CID 24760535) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-[[6-(1H-indol-2-yl)pyrazin-2-yl]amino]-3-methoxybenzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-[[6-(1H-indol-2-yl)pyrazin-2-yl]amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 24760535 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-[[6-(1H-indol-2-yl)pyrazin-2-yl]amino]-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCN(C)C)ccc1Nc1cncc(-c2cc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C25H28N6O2/c1-31(2)12-6-11-27-25(32)18-9-10-20(23(14-18)33-3)29-24-16-26-15-22(30-24)21-13-17-7-4-5-8-19(17)28-21/h4-5,7-10,13-16,28H,6,11-12H2,1-3H3,(H,27,32)(H,29,30) |
| InChIKey | VTNHHYGXQQBHGX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|