C31H26Cl2N2O3S — CID 24767353
(2E)-2-[5-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-N,N-diphenylacetamide (PubChem CID 24767353) has the molecular formula C31H26Cl2N2O3S and a molecular weight of 577.53 g/mol. Its IUPAC name is (2E)-2-[5-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-N,N-diphenylacetamide.
| Compound Name | (2E)-2-[5-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 24767353 |
| Molecular Formula | C31H26Cl2N2O3S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | (2E)-2-[5-(2,4-dichlorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-3-ylidene]-N,N-diphenylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C/C(=O)N(c3ccccc3)c3ccccc3)CC2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C31H26Cl2N2O3S/c1-22-12-15-27(16-13-22)39(37,38)34-21-23(18-30(34)28-17-14-24(32)20-29(28)33)19-31(36)35(25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-17,19-20,30H,18,21H2,1H3/b23-19+ |
| InChIKey | VSHPLVXBWNHNNZ-FCDQGJHFSA-N |
| XLogP | 7.73 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|