C20H33N3O5Si — CID 24768001
4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 24768001) has the molecular formula C20H33N3O5Si and a molecular weight of 423.59 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 24768001 |
| Molecular Formula | C20H33N3O5Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | C#C[C@@]1(O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[C@@H](n2ccc(N)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C20H33N3O5Si/c1-8-20(26)15(11-27-29(12(2)3,13(4)5)14(6)7)28-18(17(20)24)23-10-9-16(21)22-19(23)25/h1,9-10,12-15,17-18,24,26H,11H2,2-7H3,(H2,21,22,25)/t15-,17+,18-,20-/m1/s1 |
| InChIKey | ANYSPRJYLCFJFL-MJKGWSOKSA-N |
| XLogP | 1.64 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|