C21H34N4O6Si — CID 24768017
N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-2-(dimethylamino)acetamide (PubChem CID 24768017) has the molecular formula C21H34N4O6Si and a molecular weight of 466.61 g/mol. Its IUPAC name is N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 24768017 |
| Molecular Formula | C21H34N4O6Si |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[1-[(2R,3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-3,4-dihydroxyoxolan-2-yl]-2-oxopyrimidin-4-yl]-2-(dimethylamino)acetamide |
| SMILES | C#C[C@@]1(O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](n2ccc(NC(=O)CN(C)C)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C21H34N4O6Si/c1-9-21(29)14(13-30-32(7,8)20(2,3)4)31-18(17(21)27)25-11-10-15(23-19(25)28)22-16(26)12-24(5)6/h1,10-11,14,17-18,27,29H,12-13H2,2-8H3,(H,22,23,26,28)/t14-,17+,18-,21-/m1/s1 |
| InChIKey | DLUJXXZWUKGHAO-GCQDIAHQSA-N |
| XLogP | 0.39 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|