C13H18N2O7 — CID 24769927
[(1R,5S,6R,8S)-7,8-diacetyloxy-3-oxo-2,4-diazabicyclo[3.3.1]nonan-6-yl] acetate (PubChem CID 24769927) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is [(1R,5S,6R,8S)-7,8-diacetyloxy-3-oxo-2,4-diazabicyclo[3.3.1]nonan-6-yl] acetate.
| Compound Name | [(1R,5S,6R,8S)-7,8-diacetyloxy-3-oxo-2,4-diazabicyclo[3.3.1]nonan-6-yl] acetate |
|---|---|
| PubChem CID | 24769927 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(1R,5S,6R,8S)-7,8-diacetyloxy-3-oxo-2,4-diazabicyclo[3.3.1]nonan-6-yl] acetate |
| SMILES | CC(=O)OC1[C@@H](OC(C)=O)[C@H]2C[C@H](NC(=O)N2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C13H18N2O7/c1-5(16)20-10-8-4-9(15-13(19)14-8)11(21-6(2)17)12(10)22-7(3)18/h8-12H,4H2,1-3H3,(H2,14,15,19)/t8-,9+,10+,11-,12? |
| InChIKey | RTVZPMFYHUQARI-ZLERWKPPSA-N |
| XLogP | -0.76 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|