C26H28Cl2NO5P — CID 24770464
1,3-bis(4-chlorophenyl)-3-(N-diethoxyphosphoryl-4-methoxyanilino)propan-1-one (PubChem CID 24770464) has the molecular formula C26H28Cl2NO5P and a molecular weight of 536.39 g/mol. Its IUPAC name is 1,3-bis(4-chlorophenyl)-3-(N-diethoxyphosphoryl-4-methoxyanilino)propan-1-one.
| Compound Name | 1,3-bis(4-chlorophenyl)-3-(N-diethoxyphosphoryl-4-methoxyanilino)propan-1-one |
|---|---|
| PubChem CID | 24770464 |
| Molecular Formula | C26H28Cl2NO5P |
| Molecular Weight | 536.39 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 1,3-bis(4-chlorophenyl)-3-(N-diethoxyphosphoryl-4-methoxyanilino)propan-1-one |
| SMILES | CCOP(=O)(OCC)N(c1ccc(OC)cc1)C(CC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H28Cl2NO5P/c1-4-33-35(31,34-5-2)29(23-14-16-24(32-3)17-15-23)25(19-6-10-21(27)11-7-19)18-26(30)20-8-12-22(28)13-9-20/h6-17,25H,4-5,18H2,1-3H3 |
| InChIKey | YZTNTUOJQNXVEF-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.39 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|