C18H28O — CID 24772884
(2E)-3,7-dimethyl-1-[(Z)-5-methylhept-4-en-6-yn-3-yl]oxyocta-2,6-diene (PubChem CID 24772884) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-[(Z)-5-methylhept-4-en-6-yn-3-yl]oxyocta-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-[(Z)-5-methylhept-4-en-6-yn-3-yl]oxyocta-2,6-diene |
|---|---|
| PubChem CID | 24772884 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (2E)-3,7-dimethyl-1-[(Z)-5-methylhept-4-en-6-yn-3-yl]oxyocta-2,6-diene |
| SMILES | C#C/C(C)=C\C(CC)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H28O/c1-7-16(5)14-18(8-2)19-13-12-17(6)11-9-10-15(3)4/h1,10,12,14,18H,8-9,11,13H2,2-6H3/b16-14-,17-12+ |
| InChIKey | QOMGNKDZUJAZTI-UEHVZXPFSA-N |
| XLogP | 5.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|