C20H30O — CID 71614406
(2E)-3,7-dimethyl-1-[(5R)-2-methylnona-1,8-dien-3-yn-5-yl]oxyocta-2,6-diene (PubChem CID 71614406) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2E)-3,7-dimethyl-1-[(5R)-2-methylnona-1,8-dien-3-yn-5-yl]oxyocta-2,6-diene.
| Compound Name | (2E)-3,7-dimethyl-1-[(5R)-2-methylnona-1,8-dien-3-yn-5-yl]oxyocta-2,6-diene |
|---|---|
| PubChem CID | 71614406 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2E)-3,7-dimethyl-1-[(5R)-2-methylnona-1,8-dien-3-yn-5-yl]oxyocta-2,6-diene |
| SMILES | C=CCC[C@H](C#CC(=C)C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C20H30O/c1-7-8-12-20(14-13-18(4)5)21-16-15-19(6)11-9-10-17(2)3/h7,10,15,20H,1,4,8-9,11-12,16H2,2-3,5-6H3/b19-15+/t20-/m1/s1 |
| InChIKey | PJHKZUCTMWBWRF-ZWUNQBBJSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|