C8H12N2O2S — CID 24773775
(4aS,8aS)-2-methylsulfanyl-3,4a,5,6,7,8a-hexahydropyrano[2,3-d]pyrimidin-4-one (PubChem CID 24773775) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is (4aS,8aS)-2-methylsulfanyl-3,4a,5,6,7,8a-hexahydropyrano[2,3-d]pyrimidin-4-one.
| Compound Name | (4aS,8aS)-2-methylsulfanyl-3,4a,5,6,7,8a-hexahydropyrano[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24773775 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | (4aS,8aS)-2-methylsulfanyl-3,4a,5,6,7,8a-hexahydropyrano[2,3-d]pyrimidin-4-one |
| SMILES | CSC1=N[C@H]2OCCC[C@@H]2C(=O)N1 |
| InChI | InChI=1S/C8H12N2O2S/c1-13-8-9-6(11)5-3-2-4-12-7(5)10-8/h5,7H,2-4H2,1H3,(H,9,10,11)/t5-,7+/m1/s1 |
| InChIKey | JNDOQQVTAPEARE-VDTYLAMSSA-N |
| XLogP | 0.59 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |