C26H24N2O3S — CID 24776314
(2S)-3-(1H-indol-3-yl)-2-[[2-(3-phenylphenyl)-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 24776314) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[[2-(3-phenylphenyl)-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[[2-(3-phenylphenyl)-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24776314 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[[2-(3-phenylphenyl)-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(CS)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O3S/c29-25(22(16-32)19-10-6-9-18(13-19)17-7-2-1-3-8-17)28-24(26(30)31)14-20-15-27-23-12-5-4-11-21(20)23/h1-13,15,22,24,27,32H,14,16H2,(H,28,29)(H,30,31)/t22?,24-/m0/s1 |
| InChIKey | FCBRDLHNEHOMLV-GITCGBDTSA-N |
| XLogP | 4.66 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|