C20H14Cl2N6 — CID 24776569
9-benzyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile (PubChem CID 24776569) has the molecular formula C20H14Cl2N6 and a molecular weight of 409.28 g/mol. Its IUPAC name is 9-benzyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile.
| Compound Name | 9-benzyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile |
|---|---|
| PubChem CID | 24776569 |
| Molecular Formula | C20H14Cl2N6 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 9-benzyl-6-[(3,4-dichlorophenyl)methylamino]purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCc2ccc(Cl)c(Cl)c2)c2ncn(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C20H14Cl2N6/c21-15-7-6-14(8-16(15)22)10-24-19-18-20(27-17(9-23)26-19)28(12-25-18)11-13-4-2-1-3-5-13/h1-8,12H,10-11H2,(H,24,26,27) |
| InChIKey | LDNVKJRESPSQKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |