C43H56N2O6S4 — CID 24786762
[9,21-ditert-butyl-23-(hydroxymethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-7-yl]methanol (PubChem CID 24786762) has the molecular formula C43H56N2O6S4 and a molecular weight of 825.20 g/mol. Its IUPAC name is [9,21-ditert-butyl-23-(hydroxymethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-7-yl]methanol.
| Compound Name | [9,21-ditert-butyl-23-(hydroxymethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-7-yl]methanol |
|---|---|
| PubChem CID | 24786762 |
| Molecular Formula | C43H56N2O6S4 |
| Molecular Weight | 825.20 g/mol |
| Exact Mass | 824.30 |
| IUPAC Name | [9,21-ditert-butyl-23-(hydroxymethyl)-13,17-bis-(4-methylphenyl)sulfonyl-2,5-dithia-13,17-diazatricyclo[17.4.0.06,11]tricosa-1(19),6(11),7,9,20,22-hexaen-7-yl]methanol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)Cc3cc(C(C)(C)C)cc(CO)c3SCCSc3c(CO)cc(C(C)(C)C)cc3C2)cc1 |
| InChI | InChI=1S/C43H56N2O6S4/c1-30-10-14-38(15-11-30)54(48,49)44-18-9-19-45(55(50,51)39-16-12-31(2)13-17-39)27-33-23-37(43(6,7)8)25-35(29-47)41(33)53-21-20-52-40-32(26-44)22-36(42(3,4)5)24-34(40)28-46/h10-17,22-25,46-47H,9,18-21,26-29H2,1-8H3 |
| InChIKey | YUPONTQBJVXQFZ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.20 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |